Products 808756-64-1
CAS 808756-64-1 is the registry number for A778317. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-isoquinolin-5-ylurea (CAS 808756-64-1) is a chemical compound with the molecular formula C23H25N3O and a molecular weight of 359.5 g/mol. IUPAC name: 1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-isoquinolin-5-ylurea. InChIKey: VPSCJCQPUGKRNC-OAQYLSRUSA-N.
| Molecular formula | C23H25N3O |
|---|---|
| Molecular weight | 359.5 g/mol |
| IUPAC name | 1-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]-3-isoquinolin-5-ylurea |
| InChIKey | VPSCJCQPUGKRNC-OAQYLSRUSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)[C@@H](CC2)NC(=O)NC3=CC=CC4=C3C=CN=C4 |
Computed by PubChem (NCBI)