CAS 809278-96-4 is the registry number for (4-Bromo-2-chlorophenoxy)trimethylsilane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g.
(4-bromo-2-chlorophenoxy)-trimethylsilane (CAS 809278-96-4) is a chemical compound with the molecular formula C9H12BrClOSi and a molecular weight of 279.63 g/mol. IUPAC name: (4-bromo-2-chlorophenoxy)-trimethylsilane. InChIKey: JGFRMUZQBVOJSV-UHFFFAOYSA-N.
| Molecular formula | C9H12BrClOSi |
|---|---|
| Molecular weight | 279.63 g/mol |
| IUPAC name | (4-bromo-2-chlorophenoxy)-trimethylsilane |
| InChIKey | JGFRMUZQBVOJSV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)