CAS 80945-79-5 appears in our catalog under these names: 2-Hydrazinyl-5-(trifluoromethyl)-1,3-benzothiazole, 2-Hydrazino-5-(trifluoromethyl)-1,3-benzothiazole, 95%, 2–Hydrazinyl–5–(trifluoromethyl)benzo(d)thiazole. Offered by: Biosynth, Combi-blocks, GLPBio. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg.
[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]hydrazine (CAS 80945-79-5) is a chemical compound with the molecular formula C8H6F3N3S and a molecular weight of 233.22 g/mol. IUPAC name: [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]hydrazine. InChIKey: WMGILRGFFUZVAS-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1,3-benzothiazol-2-yl]hydrazine |
| InChIKey | WMGILRGFFUZVAS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(S2)NN |
Computed by PubChem (NCBI)