CAS 81-11-8 appears in our catalog under these names: 4,4’-Diaminostilbene-2,2’-disulfonic Acid, 95+%, >95% (HPLC), 4,4′-Diaminostilbene-2,2′-disulfonic Acid, 96%, 4,4'-Diaminostilbene-2,2'-disulfonic acid, 95% , 4,4'-Diaminostilbene-2,2'-disulfonic acid, 4,4'-Diaminostilbene-2,2'-disulfonic Acid, >94.0%(T). Offered by: TRC, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 5g, 100g, 50g, 500g.
5-amino-2-[2-(4-amino-2-sulfophenyl)ethenyl]benzenesulfonic acid (CAS 81-11-8) is a chemical compound with the molecular formula C14H14N2O6S2 and a molecular weight of 370.4 g/mol. IUPAC name: 5-amino-2-[2-(4-amino-2-sulfophenyl)ethenyl]benzenesulfonic acid. InChIKey: REJHVSOVQBJEBF-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O6S2 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 5-amino-2-[2-(4-amino-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| InChIKey | REJHVSOVQBJEBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)O)C=CC2=C(C=C(C=C2)N)S(=O)(=O)O |
Computed by PubChem (NCBI)