CAS 81-41-4 appears in our catalog under these names: 1,4-Diamino-2,3-dicyanoanthraquinone, min. 95 %, 1 kg, 1,4-Diamino-9,10-dioxo-9,10-dihydroanthracene-2,3-dicarbonitrile, 97%, 1，4–Diamino–2，3–dicyano–9，10–anthraquinone, 1,4-Diamino-2,3-dicyanoanthraquinone, 1,4-Diamino-9,10-dioxo-9,10-dihydroanthracene-2,3-dicarbonitrile, 90%,LC&N, 90%,LC&N. Offered by: Roth, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1kg, 1g, 5g, 500g, 250g, 1000g, 2000g, 5000g.
1,4-diamino-9,10-dioxoanthracene-2,3-dicarbonitrile (CAS 81-41-4) is a chemical compound with the molecular formula C16H8N4O2 and a molecular weight of 288.26 g/mol. IUPAC name: 1,4-diamino-9,10-dioxoanthracene-2,3-dicarbonitrile. InChIKey: QUZJFTXRXJQLBH-UHFFFAOYSA-N.
| Molecular formula | C16H8N4O2 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 1,4-diamino-9,10-dioxoanthracene-2,3-dicarbonitrile |
| InChIKey | QUZJFTXRXJQLBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C(=C(C(=C3C2=O)N)C#N)C#N)N |
Computed by PubChem (NCBI)