CAS 81-88-9 appears in our catalog under these names: Rhodamine B, Rhodamine B chloride, Rhodamine B (Basic Violet 10), Rhodamine B , Rhodamine B (C.I. 45170). Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, TargetMol, GLPBio. Available pack sizes: on request, 250mg, 100g, 250g, 500g, 1g, 100mg, 10mM (in 1ml dmso).
Rhodamine B is an organic chloride salt having N-[9-(2-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium as the counterion. An amphoteric dye commonly used as a fluorochrome. It has a role as a fluorescent probe, a fluorochrome and a histological dye. It is an organic chloride salt and a xanthene dye. It contains a rhodamine B(1+).
Source: ChEBI
| Molecular formula | C28H31ClN2O3 |
|---|---|
| Molecular weight | 479.0 g/mol |
| IUPAC name | [9-(2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium chloride |
| InChIKey | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] |
Computed by PubChem (NCBI)