Products 81050-71-7
CAS 81050-71-7 is the registry number for Chlorambucyl-proline. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-1-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]pyrrolidine-2-carboxylic acid (CAS 81050-71-7) is a chemical compound with the molecular formula C19H26Cl2N2O3 and a molecular weight of 401.3 g/mol. IUPAC name: (2S)-1-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]pyrrolidine-2-carboxylic acid. InChIKey: YNNHDRBQITYXLB-KRWDZBQOSA-N.
| Molecular formula | C19H26Cl2N2O3 |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | (2S)-1-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | YNNHDRBQITYXLB-KRWDZBQOSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CCCC2=CC=C(C=C2)N(CCCl)CCCl)C(=O)O |
Computed by PubChem (NCBI)