CAS 81059-82-7 is the registry number for 1,3,5-Tribromo-1,6-dichlorononafluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,3,5-tribromo-1,6-dichloro-1,2,2,3,4,4,5,6,6-nonafluorohexane (CAS 81059-82-7) is a chemical compound with the molecular formula C6Br3Cl2F9 and a molecular weight of 553.66 g/mol. IUPAC name: 1,3,5-tribromo-1,6-dichloro-1,2,2,3,4,4,5,6,6-nonafluorohexane. InChIKey: QJQQQFAGKHFLNC-UHFFFAOYSA-N.
| Molecular formula | C6Br3Cl2F9 |
|---|---|
| Molecular weight | 553.66 g/mol |
| IUPAC name | 1,3,5-tribromo-1,6-dichloro-1,2,2,3,4,4,5,6,6-nonafluorohexane |
| InChIKey | QJQQQFAGKHFLNC-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(Cl)Br)(F)F)(F)Br)(C(C(F)(F)Cl)(F)Br)(F)F |
Computed by PubChem (NCBI)