Products 810696-16-3

CAS 810696-16-3 is the registry number for Milnacipran Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one (CAS 810696-16-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: (1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one. InChIKey: VQWWQAXEUWHNDU-GXSJLCMTSA-N.

Identity
Molecular formulaC11H11NO
Molecular weight173.21 g/mol
IUPAC name(1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one
InChIKeyVQWWQAXEUWHNDU-GXSJLCMTSA-N
SMILESC1[C@@H]2[C@]1(C(=O)NC2)C3=CC=CC=C3

Computed by PubChem (NCBI)