CAS 810696-16-3 is the registry number for Milnacipran Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one (CAS 810696-16-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: (1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one. InChIKey: VQWWQAXEUWHNDU-GXSJLCMTSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (1S,5R)-1-phenyl-3-azabicyclo[3.1.0]hexan-2-one |
| InChIKey | VQWWQAXEUWHNDU-GXSJLCMTSA-N |
| SMILES | C1[C@@H]2[C@]1(C(=O)NC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)