Products 81080-09-3

CAS 81080-09-3 is the registry number for Amodiaquine Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]acetamide (CAS 81080-09-3) is a chemical compound with the molecular formula C18H31N3O2 and a molecular weight of 321.5 g/mol. IUPAC name: N-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]acetamide. InChIKey: DWXOUJKPLMZXRR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H31N3O2
Molecular weight321.5 g/mol
IUPAC nameN-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]acetamide
InChIKeyDWXOUJKPLMZXRR-UHFFFAOYSA-N
SMILESCCN(CC)CC1=CC(=CC(=C1O)CN(CC)CC)NC(=O)C

Computed by PubChem (NCBI)