CAS 81090-53-1 appears in our catalog under these names: 4,4'–Dibromotriphenylamine, 4,4'-Dibromotriphenylamine, 98% , 4,4'-Dibromotriphenylamine (purified by sublimation), >98.0%(GC)(T), 4,4'-Dibromotriphenylamine, >98.0%(GC)(T), 4,4'-Dibromotriphenylamine 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 200mg, 10g, 500g.
4-bromo-N-(4-bromophenyl)-N-phenylaniline (CAS 81090-53-1) is a chemical compound with the molecular formula C18H13Br2N and a molecular weight of 403.1 g/mol. IUPAC name: 4-bromo-N-(4-bromophenyl)-N-phenylaniline. InChIKey: KIGVOJUDEQXKII-UHFFFAOYSA-N.
| Molecular formula | C18H13Br2N |
|---|---|
| Molecular weight | 403.1 g/mol |
| IUPAC name | 4-bromo-N-(4-bromophenyl)-N-phenylaniline |
| InChIKey | KIGVOJUDEQXKII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)