CAS 81123-38-8 appears in our catalog under these names: 5-hydroxy Chlorosulfuron, >95% (HPLC), Chlorsulfuron-5-hydroxy, Chlorsulfuron-5-hydroxy, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1x1ml.
1-(2-chloro-5-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea (CAS 81123-38-8) is a chemical compound with the molecular formula C12H12ClN5O5S and a molecular weight of 373.77 g/mol. IUPAC name: 1-(2-chloro-5-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea. InChIKey: IVNIYQSXICOYPT-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN5O5S |
|---|---|
| Molecular weight | 373.77 g/mol |
| IUPAC name | 1-(2-chloro-5-hydroxyphenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea |
| InChIKey | IVNIYQSXICOYPT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)O)Cl |
Computed by PubChem (NCBI)