CAS 81166-48-5 is the registry number for S-(-)-DIOA. Offered by: TRC. Available pack sizes: 100mg.
2-[[(2S)-2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl]oxy]acetic acid (CAS 81166-48-5) is a chemical compound with the molecular formula C20H24Cl2O4 and a molecular weight of 399.3 g/mol. IUPAC name: 2-[[(2S)-2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl]oxy]acetic acid. InChIKey: YAWWQIFONIPBKT-FQEVSTJZSA-N.
| Molecular formula | C20H24Cl2O4 |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | 2-[[(2S)-2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl]oxy]acetic acid |
| InChIKey | YAWWQIFONIPBKT-FQEVSTJZSA-N |
| SMILES | CCCC[C@]1(CC2=CC(=C(C(=C2C1=O)Cl)Cl)OCC(=O)O)C3CCCC3 |
Computed by PubChem (NCBI)