CAS 811713-80-1 appears in our catalog under these names: 1,2-Difluoro-3,4,5-tribromobenzene, 95%, 1,2,3-Tribromo-4,5-difluorobenzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg.
1,2,3-tribromo-4,5-difluorobenzene (CAS 811713-80-1) is a chemical compound with the molecular formula C6HBr3F2 and a molecular weight of 350.78 g/mol. IUPAC name: 1,2,3-tribromo-4,5-difluorobenzene. InChIKey: RVTLACFCXXQIIA-UHFFFAOYSA-N.
| Molecular formula | C6HBr3F2 |
|---|---|
| Molecular weight | 350.78 g/mol |
| IUPAC name | 1,2,3-tribromo-4,5-difluorobenzene |
| InChIKey | RVTLACFCXXQIIA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)F)F |
Computed by PubChem (NCBI)