CAS 811841-63-1 appears in our catalog under these names: 2-(2-(N-(2,4-Difluorophenyl)carbamoyl)phenyl)acetic acid, 95%, 2-(2-(N-(2,4-Difluorophenyl)carbamoyl)phenyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 25g.
2-[2-[(2,4-difluorophenyl)carbamoyl]phenyl]acetic acid (CAS 811841-63-1) is a chemical compound with the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. IUPAC name: 2-[2-[(2,4-difluorophenyl)carbamoyl]phenyl]acetic acid. InChIKey: LJLOFJJFWQBSKL-UHFFFAOYSA-N.
| Molecular formula | C15H11F2NO3 |
|---|---|
| Molecular weight | 291.25 g/mol |
| IUPAC name | 2-[2-[(2,4-difluorophenyl)carbamoyl]phenyl]acetic acid |
| InChIKey | LJLOFJJFWQBSKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)