Products 81187-93-1
CAS 81187-93-1 is the registry number for 4-(4-Chlorophenyl)-2,5-dihydro-1H-pyrrol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-chlorophenyl)-1,2-dihydropyrrol-5-one (CAS 81187-93-1) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-dihydropyrrol-5-one. InChIKey: BKUCSIXWFMBBPC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-dihydropyrrol-5-one |
| InChIKey | BKUCSIXWFMBBPC-UHFFFAOYSA-N |
| SMILES | C1C(=CC(=O)N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)