CAS 812-72-6 appears in our catalog under these names: Allyl 1h,1h-perfluorooctyl ether, 95%, Allyl 1H,1H–perfluorooctyl ether. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg, 25g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-prop-2-enoxyoctane (CAS 812-72-6) is a chemical compound with the molecular formula C11H7F15O and a molecular weight of 440.15 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-prop-2-enoxyoctane. InChIKey: DPOFHGRLDJWXKJ-UHFFFAOYSA-N.
| Molecular formula | C11H7F15O |
|---|---|
| Molecular weight | 440.15 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-prop-2-enoxyoctane |
| InChIKey | DPOFHGRLDJWXKJ-UHFFFAOYSA-N |
| SMILES | C=CCOCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)