CAS 812-90-8 is the registry number for Methyl 3,5,6-trichlorooctafluorohexanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoate (CAS 812-90-8) is a chemical compound with the molecular formula C7H3Cl3F8O2 and a molecular weight of 377.4 g/mol. IUPAC name: methyl 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoate. InChIKey: MTPAEVBJFREPLP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3F8O2 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | methyl 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoate |
| InChIKey | MTPAEVBJFREPLP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F |
Computed by PubChem (NCBI)