CAS 81266-23-1 appears in our catalog under these names: 3-Hydroxy Benzopyrene 3-o-Sulfate Sodium Salt, Sodium Benzo(a)pyrene-3-sulfate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
Sodium benzo[a]pyren-3-yl sulfate (CAS 81266-23-1) is a chemical compound with the molecular formula C20H11NaO4S and a molecular weight of 370.4 g/mol. IUPAC name: sodium benzo[a]pyren-3-yl sulfate. InChIKey: QGPVXWSMYXSMNQ-UHFFFAOYSA-M.
| Molecular formula | C20H11NaO4S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | sodium benzo[a]pyren-3-yl sulfate |
| InChIKey | QGPVXWSMYXSMNQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C3=C4C(=CC2=C1)C=CC5=C(C=CC(=C54)C=C3)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)