CAS 813-56-9 appears in our catalog under these names: Malonic acid-d4, 95%, Malonic Acid-d4, MALONIC ACID-D4, 98 ATOM % D, 99% CP. Offered by: Combi-blocks, TRC, Sigma-Aldrich. Available pack sizes: 10g, 1g, 2,5g, 5g.
Dideuterio 2,2-dideuteriopropanedioate (CAS 813-56-9) is a chemical compound with the molecular formula C3H4O4 and a molecular weight of 108.09 g/mol. IUPAC name: dideuterio 2,2-dideuteriopropanedioate. InChIKey: OFOBLEOULBTSOW-BGOGGDMHSA-N.
| Molecular formula | C3H4O4 |
|---|---|
| Molecular weight | 108.09 g/mol |
| IUPAC name | dideuterio 2,2-dideuteriopropanedioate |
| InChIKey | OFOBLEOULBTSOW-BGOGGDMHSA-N |
| SMILES | [2H]C([2H])(C(=O)O[2H])C(=O)O[2H] |
Computed by PubChem (NCBI)