CAS 81338-23-0 appears in our catalog under these names: D-AP7, D–AP7. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, Get quote.
(2R)-2-amino-7-phosphonoheptanoic acid (CAS 81338-23-0) is a chemical compound with the molecular formula C7H16NO5P and a molecular weight of 225.18 g/mol. IUPAC name: (2R)-2-amino-7-phosphonoheptanoic acid. InChIKey: MYDMWESTDPJANS-ZCFIWIBFSA-N.
| Molecular formula | C7H16NO5P |
|---|---|
| Molecular weight | 225.18 g/mol |
| IUPAC name | (2R)-2-amino-7-phosphonoheptanoic acid |
| InChIKey | MYDMWESTDPJANS-ZCFIWIBFSA-N |
| SMILES | C(CC[C@H](C(=O)O)N)CCP(=O)(O)O |
Computed by PubChem (NCBI)