Products 81377-20-0

CAS 81377-20-0 is the registry number for 7-Chlorobenzo[c][1,2,5]oxadiazole-4-sulfonic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid (CAS 81377-20-0) is a chemical compound with the molecular formula C6H3ClN2O4S and a molecular weight of 234.62 g/mol. IUPAC name: 4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid. InChIKey: YITNZTMNWIIAGA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClN2O4S
Molecular weight234.62 g/mol
IUPAC name4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid
InChIKeyYITNZTMNWIIAGA-UHFFFAOYSA-N
SMILESC1=C(C2=NON=C2C(=C1)Cl)S(=O)(=O)O

Computed by PubChem (NCBI)