CAS 81377-20-0 is the registry number for 7-Chlorobenzo[c][1,2,5]oxadiazole-4-sulfonic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid (CAS 81377-20-0) is a chemical compound with the molecular formula C6H3ClN2O4S and a molecular weight of 234.62 g/mol. IUPAC name: 4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid. InChIKey: YITNZTMNWIIAGA-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4S |
|---|---|
| Molecular weight | 234.62 g/mol |
| IUPAC name | 4-chloro-2,1,3-benzoxadiazole-7-sulfonic acid |
| InChIKey | YITNZTMNWIIAGA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)