Products 81395-17-7
CAS 81395-17-7 is the registry number for 3-Bromoaniline-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
3-bromo-2,4,5,6-tetradeuterioaniline (CAS 81395-17-7) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 176.05 g/mol. IUPAC name: 3-bromo-2,4,5,6-tetradeuterioaniline. InChIKey: DHYHYLGCQVVLOQ-RHQRLBAQSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 176.05 g/mol |
| IUPAC name | 3-bromo-2,4,5,6-tetradeuterioaniline |
| InChIKey | DHYHYLGCQVVLOQ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Br)[2H])N)[2H] |
Computed by PubChem (NCBI)