CAS 814-71-1 appears in our catalog under these names: Bis[(2-sulfanylacetyl)oxy]calcium, 98% (contains H2O), 98% (contains H2O), Calcium 2-mercaptoacetate, 98% (contains H2O). Offered by: Chemat, Ambeed. Available pack sizes: 1kg, 25g, 100g, 500g.
Calcium bis(2-sulfanylacetate) (CAS 814-71-1) is a chemical compound with the molecular formula C4H6CaO4S2 and a molecular weight of 222.3 g/mol. IUPAC name: calcium bis(2-sulfanylacetate). InChIKey: CNYFJCCVJNARLE-UHFFFAOYSA-L.
| Molecular formula | C4H6CaO4S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | calcium bis(2-sulfanylacetate) |
| InChIKey | CNYFJCCVJNARLE-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])S.C(C(=O)[O-])S.[Ca+2] |
Computed by PubChem (NCBI)