Products 81447-81-6
CAS 81447-81-6 is the registry number for Bromadoline (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;(Z)-but-2-enedioic acid (CAS 81447-81-6) is a chemical compound with the molecular formula C19H25BrN2O5 and a molecular weight of 441.3 g/mol. IUPAC name: 4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;(Z)-but-2-enedioic acid. InChIKey: XHCXKGFNPZETQY-YHPCKPBFSA-N.
| Molecular formula | C19H25BrN2O5 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | 4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;(Z)-but-2-enedioic acid |
| InChIKey | XHCXKGFNPZETQY-YHPCKPBFSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NC(=O)C2=CC=C(C=C2)Br.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)