Products 81450-61-5
CAS 81450-61-5 is the registry number for 6-((Hydroxyimino)methyl)-2-oxo-1,2-dihydropyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(hydroxyiminomethyl)-2-oxo-1H-pyridine-3-carbonitrile (CAS 81450-61-5) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 6-(hydroxyiminomethyl)-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: SFVUUPUJNRMWJC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 6-(hydroxyiminomethyl)-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | SFVUUPUJNRMWJC-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=O)C(=C1)C#N)C=NO |
Computed by PubChem (NCBI)