CAS 81461-72-5 appears in our catalog under these names: Buspirone EP Impurity B, 8-(Pyrimidin-2-yl)-5,8-diazaspiro[4.5]decan-5-ium chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-pyrimidin-2-yl-8-aza-5-azoniaspiro[4.5]decane chloride (CAS 81461-72-5) is a chemical compound with the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. IUPAC name: 8-pyrimidin-2-yl-8-aza-5-azoniaspiro[4.5]decane chloride. InChIKey: JMDDUUPDJTXVFK-UHFFFAOYSA-M.
| Molecular formula | C12H19ClN4 |
|---|---|
| Molecular weight | 254.76 g/mol |
| IUPAC name | 8-pyrimidin-2-yl-8-aza-5-azoniaspiro[4.5]decane chloride |
| InChIKey | JMDDUUPDJTXVFK-UHFFFAOYSA-M |
| SMILES | C1CC[N+]2(C1)CCN(CC2)C3=NC=CC=N3.[Cl-] |
Computed by PubChem (NCBI)