Products 81480-39-9
CAS 81480-39-9 appears in our catalog under these names: Promethazine N-Oxide, Promethazine Impurity 2. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg.
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine oxide (CAS 81480-39-9) is a chemical compound with the molecular formula C17H20N2OS and a molecular weight of 300.4 g/mol. IUPAC name: N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine oxide. InChIKey: VSUIGOJNZBMHQV-UHFFFAOYSA-N.
| Molecular formula | C17H20N2OS |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine oxide |
| InChIKey | VSUIGOJNZBMHQV-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)[N+](C)(C)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Promethazine N-Oxide, N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine oxide, N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine oxide, 81480-39-9ree base?Promethazine Impurity 9 HCl, N,N,?-Trimethyl-10H-phenothiazine-10-ethanamine N-Oxide, N,N-Dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine N-oxide