Products 81485-04-3

CAS 81485-04-3 is the registry number for Ifosfamide Impurity F. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide (CAS 81485-04-3) is a chemical compound with the molecular formula C5H10Cl2NO2P and a molecular weight of 218.02 g/mol. IUPAC name: 2-chloro-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide. InChIKey: SBMJSKYKTAAHAB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10Cl2NO2P
Molecular weight218.02 g/mol
IUPAC name2-chloro-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide
InChIKeySBMJSKYKTAAHAB-UHFFFAOYSA-N
SMILESC1CN(P(=O)(OC1)Cl)CCCl

Computed by PubChem (NCBI)