Products 81485-25-8
CAS 81485-25-8 appears in our catalog under these names: Peretinoin, Peretinoin/ 99.86% (existing batch purity), Peretinoin (NIK333), Peretinoin 99%, 2,4,6,10,14-Hexadecapentaenoic acid, 3,7,11,15-tetramethyl-, (2E,4E,6E,10E)-, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 1mg, 2mg, 25mg, 100mg, 500mg.
(2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenoic acid (CAS 81485-25-8) is a chemical compound with the molecular formula C20H30O2 and a molecular weight of 302.5 g/mol. IUPAC name: (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenoic acid. InChIKey: UUBHZHZSIKRVIV-KCXSXWJSSA-N.
| Molecular formula | C20H30O2 |
|---|---|
| Molecular weight | 302.5 g/mol |
| IUPAC name | (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenoic acid |
| InChIKey | UUBHZHZSIKRVIV-KCXSXWJSSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/C=C/C(=C/C(=O)O)/C)/C)/C)C |
Computed by PubChem (NCBI)
Synonyms:
Peretinoin, (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenoic acid, Acyclic retinoid, 3,7,11,15-Tetramethyl-2,4,6,10,14-hexadecapentaenoic acid, 2,4,6,10,14-Hexadecapentaenoic acid, 3,7,11,15-tetramethyl-, (all-E)-, peretinoina, peretinoine, peretinoinum, Peretinoin [INN], Peretinoin (JAN)