CAS 815-76-9 is the registry number for Hexamethonium monotartrate. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
(2R,3R)-2,3-dihydroxybutanedioate;trimethyl-[6-(trimethylazaniumyl)hexyl]azanium (CAS 815-76-9) is a chemical compound with the molecular formula C16H34N2O6 and a molecular weight of 350.45 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioate;trimethyl-[6-(trimethylazaniumyl)hexyl]azanium. InChIKey: XQYVGVKPIWLENM-LREBCSMRSA-L.
| Molecular formula | C16H34N2O6 |
|---|---|
| Molecular weight | 350.45 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioate;trimethyl-[6-(trimethylazaniumyl)hexyl]azanium |
| InChIKey | XQYVGVKPIWLENM-LREBCSMRSA-L |
| SMILES | C[N+](C)(C)CCCCCC[N+](C)(C)C.[C@@H]([C@H](C(=O)[O-])O)(C(=O)[O-])O |
Computed by PubChem (NCBI)