CAS 81540-86-5 appears in our catalog under these names: Dihomo–γ–Linolenic Acid–d6, cis-8,11,14-Eicosatrienoic Acid-d6, Dihomo-γ-linolenic acid-d6, 99.0%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 5mg, on request, 50mg, 1mg, 100μg, 500μg, 1 mg (3.20 mM * 1 mL in Methyl acetate).
(8Z,11Z,14Z)-8,9,11,12,14,15-hexadeuterioicosa-8,11,14-trienoic acid (CAS 81540-86-5) is a chemical compound with the molecular formula C20H34O2 and a molecular weight of 312.5 g/mol. IUPAC name: (8Z,11Z,14Z)-8,9,11,12,14,15-hexadeuterioicosa-8,11,14-trienoic acid. InChIKey: HOBAELRKJCKHQD-JALKMEHMSA-N.
| Molecular formula | C20H34O2 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | (8Z,11Z,14Z)-8,9,11,12,14,15-hexadeuterioicosa-8,11,14-trienoic acid |
| InChIKey | HOBAELRKJCKHQD-JALKMEHMSA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\C/C(=C(/[2H])\CCCCCCC(=O)O)/[2H])/[2H])/CCCCC |
Computed by PubChem (NCBI)