CAS 81559-77-5 is the registry number for (3-(2-aminophenyl)(2,4,5-oxadiazolyl))(4-chlorophenyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
5-(2-aminophenyl)-N-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 81559-77-5) is a chemical compound with the molecular formula C14H11ClN4O and a molecular weight of 286.71 g/mol. IUPAC name: 5-(2-aminophenyl)-N-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: SQTGQAKBCFLHLE-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4O |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 5-(2-aminophenyl)-N-(4-chlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | SQTGQAKBCFLHLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)NC3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)