CAS 81574-72-3 is the registry number for 1-Bromo-2-chloro-3,5-dimethoxybenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-2-chloro-3,5-dimethoxybenzene (CAS 81574-72-3) is a chemical compound with the molecular formula C8H8BrClO2 and a molecular weight of 251.50 g/mol. IUPAC name: 1-bromo-2-chloro-3,5-dimethoxybenzene. InChIKey: DDWCSARAFAAXOC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2 |
|---|---|
| Molecular weight | 251.50 g/mol |
| IUPAC name | 1-bromo-2-chloro-3,5-dimethoxybenzene |
| InChIKey | DDWCSARAFAAXOC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)Cl)OC |
Computed by PubChem (NCBI)