Products 81608-06-2
CAS 81608-06-2 is the registry number for 5-Br-PAPS. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid (CAS 81608-06-2) is a chemical compound with the molecular formula C17H21BrN4O4S and a molecular weight of 457.3 g/mol. IUPAC name: 3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid. InChIKey: BZRWWAYVITZYRZ-UHFFFAOYSA-N.
| Molecular formula | C17H21BrN4O4S |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | 3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid |
| InChIKey | BZRWWAYVITZYRZ-UHFFFAOYSA-N |
| SMILES | CCCN(CCCS(=O)(=O)O)C1=CC(=C(C=C1)N=NC2=NC=C(C=C2)Br)O |
Computed by PubChem (NCBI)