CAS 81613-60-7 is the registry number for Flupropadine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-tert-butylpiperidine;hydrochloride (CAS 81613-60-7) is a chemical compound with the molecular formula C20H24ClF6N and a molecular weight of 427.9 g/mol. IUPAC name: 1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-tert-butylpiperidine;hydrochloride. InChIKey: NLECRQYFKWPVEQ-UHFFFAOYSA-N.
| Molecular formula | C20H24ClF6N |
|---|---|
| Molecular weight | 427.9 g/mol |
| IUPAC name | 1-[3-[3,5-bis(trifluoromethyl)phenyl]prop-2-ynyl]-4-tert-butylpiperidine;hydrochloride |
| InChIKey | NLECRQYFKWPVEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCN(CC1)CC#CC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)