CAS 81638-86-0 appears in our catalog under these names: Phe-leu amide hydrochloride, 95%, (S)-2-((S)-2-Amino-3-phenylpropanamido)-4-methylpentanamide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrochloride (CAS 81638-86-0) is a chemical compound with the molecular formula C15H24ClN3O2 and a molecular weight of 313.82 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrochloride. InChIKey: YRENTNOEBSBIHY-QNTKWALQSA-N.
| Molecular formula | C15H24ClN3O2 |
|---|---|
| Molecular weight | 313.82 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrochloride |
| InChIKey | YRENTNOEBSBIHY-QNTKWALQSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)