CAS 81639-99-8 appears in our catalog under these names: bis(2,6-dimethylphenyl) chlorophosphonate, 95%, Bis(2,6–dimethylphenyl) Chlorophosphate, Bis(2,6-dimethylphenyl) Chlorophosphate, >93.0%(T). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 1g, 25g.
2-[chloro-(2,6-dimethylphenoxy)phosphoryl]oxy-1,3-dimethylbenzene (CAS 81639-99-8) is a chemical compound with the molecular formula C16H18ClO3P and a molecular weight of 324.74 g/mol. IUPAC name: 2-[chloro-(2,6-dimethylphenoxy)phosphoryl]oxy-1,3-dimethylbenzene. InChIKey: WXCXJSOCIOHPLT-UHFFFAOYSA-N.
| Molecular formula | C16H18ClO3P |
|---|---|
| Molecular weight | 324.74 g/mol |
| IUPAC name | 2-[chloro-(2,6-dimethylphenoxy)phosphoryl]oxy-1,3-dimethylbenzene |
| InChIKey | WXCXJSOCIOHPLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OP(=O)(OC2=C(C=CC=C2C)C)Cl |
Computed by PubChem (NCBI)