CAS 81654-07-1 is the registry number for 2,4-Bis(trifluoromethyl)-1H-imidazole. Offered by: TRC. Available pack sizes: 100mg.
2,5-bis(trifluoromethyl)-1H-imidazole (CAS 81654-07-1) is a chemical compound with the molecular formula C5H2F6N2 and a molecular weight of 204.07 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)-1H-imidazole. InChIKey: XDDZLUYCWFGXET-UHFFFAOYSA-N.
| Molecular formula | C5H2F6N2 |
|---|---|
| Molecular weight | 204.07 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)-1H-imidazole |
| InChIKey | XDDZLUYCWFGXET-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)