CAS 81675-81-2 appears in our catalog under these names: tert-Butylimino-tris(dimethylamino)phosphorane, 95%, PHOSPHAZENE BASE P1-T-BU, >=97.0%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 25g, 5g, 25ML, 5ML.
N-[tert-butylimino-bis(dimethylamino)-lambda5-phosphanyl]-N-methylmethanamine (CAS 81675-81-2) is a chemical compound with the molecular formula C10H27N4P and a molecular weight of 234.32 g/mol. IUPAC name: N-[tert-butylimino-bis(dimethylamino)-lambda5-phosphanyl]-N-methylmethanamine. InChIKey: YRNOSHBJMBLOSL-UHFFFAOYSA-N.
| Molecular formula | C10H27N4P |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | N-[tert-butylimino-bis(dimethylamino)-lambda5-phosphanyl]-N-methylmethanamine |
| InChIKey | YRNOSHBJMBLOSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=P(N(C)C)(N(C)C)N(C)C |
Computed by PubChem (NCBI)