CAS 817166-73-7 is the registry number for 3-Triisopropylsilyloxy-benzaldehyde. Offered by: TRC. Available pack sizes: 2,5g.
3-tri(propan-2-yl)silyloxybenzaldehyde (CAS 817166-73-7) is a chemical compound with the molecular formula C16H26O2Si and a molecular weight of 278.46 g/mol. IUPAC name: 3-tri(propan-2-yl)silyloxybenzaldehyde. InChIKey: NJZLKOAGFVCIFK-UHFFFAOYSA-N.
| Molecular formula | C16H26O2Si |
|---|---|
| Molecular weight | 278.46 g/mol |
| IUPAC name | 3-tri(propan-2-yl)silyloxybenzaldehyde |
| InChIKey | NJZLKOAGFVCIFK-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OC1=CC=CC(=C1)C=O |
Computed by PubChem (NCBI)