Products 81732-52-7
CAS 81732-52-7 appears in our catalog under these names: Bambuterol EP Impurity C HCl, Bambuterol Impurity 1, Bambuterol Monocarbamate Hydrochloride, >95% (HPLC), Bambuterol Monocarbamate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate;hydrochloride (CAS 81732-52-7) is a chemical compound with the molecular formula C15H25ClN2O4 and a molecular weight of 332.82 g/mol. IUPAC name: [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate;hydrochloride. InChIKey: JVIRNXYMUZQGGQ-UHFFFAOYSA-N.
| Molecular formula | C15H25ClN2O4 |
|---|---|
| Molecular weight | 332.82 g/mol |
| IUPAC name | [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate;hydrochloride |
| InChIKey | JVIRNXYMUZQGGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)O)O.Cl |
Computed by PubChem (NCBI)