CAS 81742-10-1 appears in our catalog under these names: Fluorescein Impurity 2 (3,6-Dichlorotrimellitic Anhydride), 3,6-Dichlorotrimellitic anhydride/ 98.68% (existing batch purity), 3,6-Dichlorotrimellitic Anhydride, 97%, 97%, 3,6-Dichlorotrimellitic anhydride, 98.0%, 5-Isobenzofurancarboxylic acid, 4,7-dichloro-1,3-dihydro-1,3-dioxo-, 97%. Offered by: Chemat Brand, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
4,7-dichloro-1,3-dioxo-2-benzofuran-5-carboxylic acid (CAS 81742-10-1) is a chemical compound with the molecular formula C9H2Cl2O5 and a molecular weight of 261.01 g/mol. IUPAC name: 4,7-dichloro-1,3-dioxo-2-benzofuran-5-carboxylic acid. InChIKey: OCUQMPDZMXSVFG-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl2O5 |
|---|---|
| Molecular weight | 261.01 g/mol |
| IUPAC name | 4,7-dichloro-1,3-dioxo-2-benzofuran-5-carboxylic acid |
| InChIKey | OCUQMPDZMXSVFG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=C1Cl)C(=O)OC2=O)Cl)C(=O)O |
Computed by PubChem (NCBI)