CAS 817635-93-1 appears in our catalog under these names: PU 23, PU23, PU 23, N-((4-(N-Benzylsulfamoyl)phenyl)carbamothioyl)benzamide, 98%, 98%, PU 23, 99.48%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 200mg, 25mg, 5mg, 50mg, 500mg.
N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]benzamide (CAS 817635-93-1) is a chemical compound with the molecular formula C21H19N3O3S2 and a molecular weight of 425.5 g/mol. IUPAC name: N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]benzamide. InChIKey: RYIRRFWVFHEXTH-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O3S2 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | N-[[4-(benzylsulfamoyl)phenyl]carbamothioyl]benzamide |
| InChIKey | RYIRRFWVFHEXTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)C2=CC=C(C=C2)NC(=S)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)