CAS 81781-90-0 appears in our catalog under these names: Theophylline Impurity 6, 7-(2-Chloroethyl)-3,7-dihydro-1,3-dimethyl-8-(phenylmethyl)-1H-purine-2,6-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
8-benzyl-7-(2-chloroethyl)-1,3-dimethylpurine-2,6-dione (CAS 81781-90-0) is a chemical compound with the molecular formula C16H17ClN4O2 and a molecular weight of 332.78 g/mol. IUPAC name: 8-benzyl-7-(2-chloroethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: SCHFDMUXIZIWJD-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN4O2 |
|---|---|
| Molecular weight | 332.78 g/mol |
| IUPAC name | 8-benzyl-7-(2-chloroethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | SCHFDMUXIZIWJD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)CC3=CC=CC=C3)CCCl |
Computed by PubChem (NCBI)