CAS 81809-75-8 is the registry number for 2-Trifluoromethyl-7-isopropoxyphenothiazine. Offered by: TRC. Available pack sizes: 100mg.
7-propan-2-yloxy-2-(trifluoromethyl)-10H-phenothiazine (CAS 81809-75-8) is a chemical compound with the molecular formula C16H14F3NOS and a molecular weight of 325.4 g/mol. IUPAC name: 7-propan-2-yloxy-2-(trifluoromethyl)-10H-phenothiazine. InChIKey: YOWQODMBLUPGFU-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NOS |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 7-propan-2-yloxy-2-(trifluoromethyl)-10H-phenothiazine |
| InChIKey | YOWQODMBLUPGFU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)NC3=C(S2)C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)