CAS 81882-18-0 appears in our catalog under these names: 1-(1-Benzofuran-2-yl)methanamine hydrochloride, 95%, 1-Benzofuran-2-ylmethanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g.
1-benzofuran-2-ylmethanamine;hydrochloride (CAS 81882-18-0) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 1-benzofuran-2-ylmethanamine;hydrochloride. InChIKey: ORSCEBONMBYAHW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 1-benzofuran-2-ylmethanamine;hydrochloride |
| InChIKey | ORSCEBONMBYAHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)CN.Cl |
Computed by PubChem (NCBI)