CAS 819053-49-1 is the registry number for 3-Azidopropyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 2000mg.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-azidopropoxy)oxan-2-yl]methyl acetate (CAS 819053-49-1) is a chemical compound with the molecular formula C17H25N3O10 and a molecular weight of 431.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-azidopropoxy)oxan-2-yl]methyl acetate. InChIKey: ZJVNXSHFGLQZEA-DRRXZNNHSA-N.
| Molecular formula | C17H25N3O10 |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-azidopropoxy)oxan-2-yl]methyl acetate |
| InChIKey | ZJVNXSHFGLQZEA-DRRXZNNHSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OCCCN=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)