CAS 81921-35-9 appears in our catalog under these names: N6-Methyladenosine-5'-monophosphate sodium salt, 95%, N6-Methyladenosine 5'-monophosphate disodium salt, 95%, N6-Methyladenosine 5'-monophosphate disodium salt/ 99.36% (existing batch purity), N6–Methyladenosine 5'–monophosphate (sodium salt), N6-Methyladenosine-5'-monophosphate sodium. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 2mg, 10mg, 25mg, 5mg, 50mg, 25 mg.
Disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl phosphate (CAS 81921-35-9) is a chemical compound with the molecular formula C11H14N5Na2O7P and a molecular weight of 405.21 g/mol. IUPAC name: disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl phosphate. InChIKey: HFOKUKRAZPHTHH-LYYWGVPGSA-L.
| Molecular formula | C11H14N5Na2O7P |
|---|---|
| Molecular weight | 405.21 g/mol |
| IUPAC name | disodium;[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl phosphate |
| InChIKey | HFOKUKRAZPHTHH-LYYWGVPGSA-L |
| SMILES | CNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)