Products 81943-62-6
CAS 81943-62-6 is the registry number for Boesenbergin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-[7-hydroxy-5-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-3-phenylprop-2-en-1-one (CAS 81943-62-6) is a chemical compound with the molecular formula C26H28O4 and a molecular weight of 404.5 g/mol. IUPAC name: (E)-1-[7-hydroxy-5-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-3-phenylprop-2-en-1-one. InChIKey: CTWSWRSNFKNYMF-OUKQBFOZSA-N.
| Molecular formula | C26H28O4 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | (E)-1-[7-hydroxy-5-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-3-phenylprop-2-en-1-one |
| InChIKey | CTWSWRSNFKNYMF-OUKQBFOZSA-N |
| SMILES | CC(=CCCC1(C=CC2=C(C=C(C(=C2O1)C(=O)/C=C/C3=CC=CC=C3)O)OC)C)C |
Computed by PubChem (NCBI)
Synonyms:
boesenbergin A, orb3179821